About 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole
4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 130511810) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole.
Analyze 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole?
The IUPAC name of 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole (CID 130511810) is 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole.
What is the SMILES notation for 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole?
The canonical SMILES for 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole is CC1CCc2scnc2C1C.
What is the InChIKey of 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole?
The InChIKey is QEFJAQLWSFKFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS/c1-6-3-4-8-9(7(6)2)10-5-11-8/h5-7H,3-4H2,1-2H3.
What are the key properties of 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole?
4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole has a molecular weight of 167.28 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole is sourced from PubChem (CID 130511810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).