C11H9ClF2O — CID 130512146
2-(6-chloro-2,3-difluorophenyl)cyclopentan-1-one (PubChem CID 130512146) has the molecular formula C11H9ClF2O and a molecular weight of 230.64 g/mol. Its IUPAC name is 2-(6-chloro-2,3-difluorophenyl)cyclopentan-1-one.
| Compound Name | 2-(6-chloro-2,3-difluorophenyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 130512146 |
| Molecular Formula | C11H9ClF2O |
| Molecular Weight | 230.64 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-(6-chloro-2,3-difluorophenyl)cyclopentan-1-one |
| SMILES | O=C1CCCC1c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C11H9ClF2O/c12-7-4-5-8(13)11(14)10(7)6-2-1-3-9(6)15/h4-6H,1-3H2 |
| InChIKey | HLWJPIHACLZQLA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|