About 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole
4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole (PubChem CID 130512297) has the molecular formula C9H12ClNOS2
and a molecular weight of 249.79 g/mol. Its IUPAC name is 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole |
| PubChem CID | 130512297 |
| Molecular Formula | C9H12ClNOS2 |
| Molecular Weight | 249.79 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole |
| SMILES | ClCCc1csc(C2CSCCO2)n1 |
| InChI | InChI=1S/C9H12ClNOS2/c10-2-1-7-5-14-9(11-7)8-6-13-4-3-12-8/h5,8H,1-4,6H2 |
| InChIKey | REMNDTFVURUWJX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole?
The IUPAC name of 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole (CID 130512297) is 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole.
What is the SMILES notation for 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole?
The canonical SMILES for 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole is ClCCc1csc(C2CSCCO2)n1.
What is the InChIKey of 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole?
The InChIKey is REMNDTFVURUWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClNOS2/c10-2-1-7-5-14-9(11-7)8-6-13-4-3-12-8/h5,8H,1-4,6H2.
What are the key properties of 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole?
4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole has a molecular weight of 249.79 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethyl)-2-(1,4-oxathian-2-yl)-1,3-thiazole is sourced from PubChem (CID 130512297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).