C10H16ClN3 — CID 130512726
N-(2-chloropropyl)-2-ethyl-6-methylpyrimidin-4-amine (PubChem CID 130512726) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is N-(2-chloropropyl)-2-ethyl-6-methylpyrimidin-4-amine.
| Compound Name | N-(2-chloropropyl)-2-ethyl-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 130512726 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-(2-chloropropyl)-2-ethyl-6-methylpyrimidin-4-amine |
| SMILES | CCc1nc(C)cc(NCC(C)Cl)n1 |
| InChI | InChI=1S/C10H16ClN3/c1-4-9-13-8(3)5-10(14-9)12-6-7(2)11/h5,7H,4,6H2,1-3H3,(H,12,13,14) |
| InChIKey | JKCYUWISNGCLKP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|