About N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine
N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine (PubChem CID 130513044) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
| PubChem CID | 130513044 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
| SMILES | CC(NC1=NCC(C)(C)CN1)C1CC1 |
| InChI | InChI=1S/C11H21N3/c1-8(9-4-5-9)14-10-12-6-11(2,3)7-13-10/h8-9H,4-7H2,1-3H3,(H2,12,13,14) |
| InChIKey | SATKECANTLZQRE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine?
The IUPAC name of N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine (CID 130513044) is N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine.
What is the SMILES notation for N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine?
The canonical SMILES for N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine is CC(NC1=NCC(C)(C)CN1)C1CC1.
What is the InChIKey of N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine?
The InChIKey is SATKECANTLZQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-8(9-4-5-9)14-10-12-6-11(2,3)7-13-10/h8-9H,4-7H2,1-3H3,(H2,12,13,14).
What are the key properties of N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine?
N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine has a molecular weight of 195.31 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropylethyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine is sourced from PubChem (CID 130513044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).