About N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine
N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine (PubChem CID 130513115) has the molecular formula C9H18FN3
and a molecular weight of 187.26 g/mol. Its IUPAC name is N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
| PubChem CID | 130513115 |
| Molecular Formula | C9H18FN3 |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
| SMILES | CC1(C)CN=C(NCCCF)NC1 |
| InChI | InChI=1S/C9H18FN3/c1-9(2)6-12-8(13-7-9)11-5-3-4-10/h3-7H2,1-2H3,(H2,11,12,13) |
| InChIKey | GXNBKWVOJOKTAF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine?
The IUPAC name of N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine (CID 130513115) is N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine.
What is the SMILES notation for N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine?
The canonical SMILES for N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine is CC1(C)CN=C(NCCCF)NC1.
What is the InChIKey of N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine?
The InChIKey is GXNBKWVOJOKTAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FN3/c1-9(2)6-12-8(13-7-9)11-5-3-4-10/h3-7H2,1-2H3,(H2,11,12,13).
What are the key properties of N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine?
N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine has a molecular weight of 187.26 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoropropyl)-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine is sourced from PubChem (CID 130513115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).