C10H11NOS — CID 130513221
1-[hydroxy-(5-methylthiophen-2-yl)methyl]cyclopropane-1-carbonitrile (PubChem CID 130513221) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 1-[hydroxy-(5-methylthiophen-2-yl)methyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[hydroxy-(5-methylthiophen-2-yl)methyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 130513221 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 1-[hydroxy-(5-methylthiophen-2-yl)methyl]cyclopropane-1-carbonitrile |
| SMILES | Cc1ccc(C(O)C2(C#N)CC2)s1 |
| InChI | InChI=1S/C10H11NOS/c1-7-2-3-8(13-7)9(12)10(6-11)4-5-10/h2-3,9,12H,4-5H2,1H3 |
| InChIKey | LCLCBJKEDIVTKK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |