About (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile
(2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile (PubChem CID 13051468) has the molecular formula C17H11F3N2S
and a molecular weight of 332.35 g/mol. Its IUPAC name is (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile.
Molecular Properties
| Compound Name | (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile |
| PubChem CID | 13051468 |
| Molecular Formula | C17H11F3N2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile |
| SMILES | N#C/C(=C1\CSc2ccccc2N1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11F3N2S/c18-17(19,20)12-5-3-4-11(8-12)13(9-21)15-10-23-16-7-2-1-6-14(16)22-15/h1-8,22H,10H2/b15-13- |
| InChIKey | KXCACFVGDJUNTK-SQFISAMPSA-N |
| XLogP | 5.16 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile?
The IUPAC name of (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile (CID 13051468) is (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile.
What is the SMILES notation for (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile?
The canonical SMILES for (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile is N#C/C(=C1\CSc2ccccc2N1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile?
The InChIKey is KXCACFVGDJUNTK-SQFISAMPSA-N. The full InChI is InChI=1S/C17H11F3N2S/c18-17(19,20)12-5-3-4-11(8-12)13(9-21)15-10-23-16-7-2-1-6-14(16)22-15/h1-8,22H,10H2/b15-13-.
What are the key properties of (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile?
(2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile has a molecular weight of 332.35 g/mol, XLogP of 5.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile is sourced from PubChem (CID 13051468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).