C27H47ClO2 — CID 13051562
(3S,5S,8R,9S,10S,13S,14S,17R)-17-[(2S,3S)-6-chloro-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 13051562) has the molecular formula C27H47ClO2 and a molecular weight of 439.12 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13S,14S,17R)-17-[(2S,3S)-6-chloro-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8R,9S,10S,13S,14S,17R)-17-[(2S,3S)-6-chloro-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 13051562 |
| Molecular Formula | C27H47ClO2 |
| Molecular Weight | 439.12 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | (3S,5S,8R,9S,10S,13S,14S,17R)-17-[(2S,3S)-6-chloro-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@H]([C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)[C@@H](O)CCC(C)(C)Cl |
| InChI | InChI=1S/C27H47ClO2/c1-17(24(30)12-13-25(2,3)28)21-8-9-22-20-7-6-18-16-19(29)10-14-26(18,4)23(20)11-15-27(21,22)5/h17-24,29-30H,6-16H2,1-5H3/t17-,18-,19-,20-,21+,22-,23-,24-,26-,27+/m0/s1 |
| InChIKey | NHWWSHXFHYTWOI-FQYUIGOQSA-N |
| XLogP | 6.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.12 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|