C11H14ClNO — CID 130515953
1-chloro-3-(2,3-dihydro-1H-isoindol-1-yl)propan-2-ol (PubChem CID 130515953) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 1-chloro-3-(2,3-dihydro-1H-isoindol-1-yl)propan-2-ol.
| Compound Name | 1-chloro-3-(2,3-dihydro-1H-isoindol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 130515953 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-chloro-3-(2,3-dihydro-1H-isoindol-1-yl)propan-2-ol |
| SMILES | OC(CCl)CC1NCc2ccccc21 |
| InChI | InChI=1S/C11H14ClNO/c12-6-9(14)5-11-10-4-2-1-3-8(10)7-13-11/h1-4,9,11,13-14H,5-7H2 |
| InChIKey | PMSFWYRPKFICTC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|