C10H16ClN3 — CID 130516358
1-[2-(3-chloropyrrolidin-1-yl)ethyl]-4-methylpyrazole (PubChem CID 130516358) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is 1-[2-(3-chloropyrrolidin-1-yl)ethyl]-4-methylpyrazole.
| Compound Name | 1-[2-(3-chloropyrrolidin-1-yl)ethyl]-4-methylpyrazole |
|---|---|
| PubChem CID | 130516358 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-[2-(3-chloropyrrolidin-1-yl)ethyl]-4-methylpyrazole |
| SMILES | Cc1cnn(CCN2CCC(Cl)C2)c1 |
| InChI | InChI=1S/C10H16ClN3/c1-9-6-12-14(7-9)5-4-13-3-2-10(11)8-13/h6-7,10H,2-5,8H2,1H3 |
| InChIKey | SMAMSICYRPSGBP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|