C10H12N2O2 — CID 130517287
1-[(5-oxopyrrolidin-2-yl)methyl]pyridin-2-one (PubChem CID 130517287) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-[(5-oxopyrrolidin-2-yl)methyl]pyridin-2-one.
| Compound Name | 1-[(5-oxopyrrolidin-2-yl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 130517287 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-[(5-oxopyrrolidin-2-yl)methyl]pyridin-2-one |
| SMILES | O=C1CCC(Cn2ccccc2=O)N1 |
| InChI | InChI=1S/C10H12N2O2/c13-9-5-4-8(11-9)7-12-6-2-1-3-10(12)14/h1-3,6,8H,4-5,7H2,(H,11,13) |
| InChIKey | YKZLOQPPWNTHSU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |