About 3-methoxyoxolane-2,5-dione
3-methoxyoxolane-2,5-dione (PubChem CID 13051736) has the molecular formula C5H6O4
and a molecular weight of 130.10 g/mol. Its IUPAC name is 3-methoxyoxolane-2,5-dione.
Molecular Properties
| Compound Name | 3-methoxyoxolane-2,5-dione |
| PubChem CID | 13051736 |
| Molecular Formula | C5H6O4 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 3-methoxyoxolane-2,5-dione |
| SMILES | COC1CC(=O)OC1=O |
| InChI | InChI=1S/C5H6O4/c1-8-3-2-4(6)9-5(3)7/h3H,2H2,1H3 |
| InChIKey | IXYFWABPTUIGTD-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxyoxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyoxolane-2,5-dione?
The IUPAC name of 3-methoxyoxolane-2,5-dione (CID 13051736) is 3-methoxyoxolane-2,5-dione.
What is the SMILES notation for 3-methoxyoxolane-2,5-dione?
The canonical SMILES for 3-methoxyoxolane-2,5-dione is COC1CC(=O)OC1=O.
What is the InChIKey of 3-methoxyoxolane-2,5-dione?
The InChIKey is IXYFWABPTUIGTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4/c1-8-3-2-4(6)9-5(3)7/h3H,2H2,1H3.
What are the key properties of 3-methoxyoxolane-2,5-dione?
3-methoxyoxolane-2,5-dione has a molecular weight of 130.10 g/mol, XLogP of -0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyoxolane-2,5-dione is sourced from PubChem (CID 13051736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).