About 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole
5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole (PubChem CID 130517374) has the molecular formula C10H16ClNO
and a molecular weight of 201.70 g/mol. Its IUPAC name is 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole |
| PubChem CID | 130517374 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole |
| SMILES | CC(C)C(c1cc(Cl)on1)C(C)C |
| InChI | InChI=1S/C10H16ClNO/c1-6(2)10(7(3)4)8-5-9(11)13-12-8/h5-7,10H,1-4H3 |
| InChIKey | YRIXREYIPNBSFI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole?
The IUPAC name of 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole (CID 130517374) is 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole.
What is the SMILES notation for 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole?
The canonical SMILES for 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole is CC(C)C(c1cc(Cl)on1)C(C)C.
What is the InChIKey of 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole?
The InChIKey is YRIXREYIPNBSFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClNO/c1-6(2)10(7(3)4)8-5-9(11)13-12-8/h5-7,10H,1-4H3.
What are the key properties of 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole?
5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole has a molecular weight of 201.70 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(2,4-dimethylpentan-3-yl)-1,2-oxazole is sourced from PubChem (CID 130517374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).