About 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde
2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 130517750) has the molecular formula C8H6N2O2S
and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 130517750 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(-c2ncc(C=O)s2)co1 |
| InChI | InChI=1S/C8H6N2O2S/c1-5-10-7(4-12-5)8-9-2-6(3-11)13-8/h2-4H,1H3 |
| InChIKey | SJFRZNYDJNPHSZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde (CID 130517750) is 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde is Cc1nc(-c2ncc(C=O)s2)co1.
What is the InChIKey of 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde?
The InChIKey is SJFRZNYDJNPHSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c1-5-10-7(4-12-5)8-9-2-6(3-11)13-8/h2-4H,1H3.
What are the key properties of 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde?
2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde has a molecular weight of 194.22 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-oxazol-4-yl)-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 130517750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).