C11H24N2O — CID 130522025
(2R)-3,3-dimethyl-1-(2-methylmorpholin-4-yl)butan-2-amine (PubChem CID 130522025) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-1-(2-methylmorpholin-4-yl)butan-2-amine.
| Compound Name | (2R)-3,3-dimethyl-1-(2-methylmorpholin-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 130522025 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | (2R)-3,3-dimethyl-1-(2-methylmorpholin-4-yl)butan-2-amine |
| SMILES | CC1CN(C[C@H](N)C(C)(C)C)CCO1 |
| InChI | InChI=1S/C11H24N2O/c1-9-7-13(5-6-14-9)8-10(12)11(2,3)4/h9-10H,5-8,12H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | WCVOUIRTFLAVKT-AXDSSHIGSA-N |
| XLogP | 1.08 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |