About 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one
4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one (PubChem CID 130522246) has the molecular formula C7H10N2O4S
and a molecular weight of 218.23 g/mol. Its IUPAC name is 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one |
| PubChem CID | 130522246 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(C(=O)N2CC(O)CO2)CS1 |
| InChI | InChI=1S/C7H10N2O4S/c10-4-1-9(13-2-4)6(11)5-3-14-7(12)8-5/h4-5,10H,1-3H2,(H,8,12) |
| InChIKey | UJJZHTMSYSWOGX-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one?
The IUPAC name of 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one (CID 130522246) is 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one.
What is the SMILES notation for 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one?
The canonical SMILES for 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one is O=C1NC(C(=O)N2CC(O)CO2)CS1.
What is the InChIKey of 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one?
The InChIKey is UJJZHTMSYSWOGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4S/c10-4-1-9(13-2-4)6(11)5-3-14-7(12)8-5/h4-5,10H,1-3H2,(H,8,12).
What are the key properties of 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one?
4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one has a molecular weight of 218.23 g/mol, XLogP of -1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxy-1,2-oxazolidine-2-carbonyl)-1,3-thiazolidin-2-one is sourced from PubChem (CID 130522246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).