About (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone
(4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone (PubChem CID 130522384) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone |
| PubChem CID | 130522384 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC(O)CO2)on1 |
| InChI | InChI=1S/C8H10N2O4/c1-5-2-7(14-9-5)8(12)10-3-6(11)4-13-10/h2,6,11H,3-4H2,1H3 |
| InChIKey | WBKZEBLXBVLMGZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone?
The IUPAC name of (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone (CID 130522384) is (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone.
What is the SMILES notation for (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone?
The canonical SMILES for (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone is Cc1cc(C(=O)N2CC(O)CO2)on1.
What is the InChIKey of (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone?
The InChIKey is WBKZEBLXBVLMGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-5-2-7(14-9-5)8(12)10-3-6(11)4-13-10/h2,6,11H,3-4H2,1H3.
What are the key properties of (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone?
(4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone has a molecular weight of 198.18 g/mol, XLogP of -0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-1,2-oxazolidin-2-yl)-(3-methyl-1,2-oxazol-5-yl)methanone is sourced from PubChem (CID 130522384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).