About 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile
2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile (PubChem CID 130522979) has the molecular formula C6H10N2O4S
and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile.
Molecular Properties
| Compound Name | 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile |
| PubChem CID | 130522979 |
| Molecular Formula | C6H10N2O4S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile |
| SMILES | CC(C#N)S(=O)(=O)N1C[C@@H](O)CO1 |
| InChI | InChI=1S/C6H10N2O4S/c1-5(2-7)13(10,11)8-3-6(9)4-12-8/h5-6,9H,3-4H2,1H3/t5?,6-/m1/s1 |
| InChIKey | AWPVSXLFXIUUCK-PRJDIBJQSA-N |
| XLogP | -1.16 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile?
The IUPAC name of 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile (CID 130522979) is 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile.
What is the SMILES notation for 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile?
The canonical SMILES for 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile is CC(C#N)S(=O)(=O)N1C[C@@H](O)CO1.
What is the InChIKey of 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile?
The InChIKey is AWPVSXLFXIUUCK-PRJDIBJQSA-N. The full InChI is InChI=1S/C6H10N2O4S/c1-5(2-7)13(10,11)8-3-6(9)4-12-8/h5-6,9H,3-4H2,1H3/t5?,6-/m1/s1.
What are the key properties of 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile?
2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile has a molecular weight of 206.22 g/mol, XLogP of -1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]sulfonyl]propanenitrile is sourced from PubChem (CID 130522979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).