About 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol
2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol (PubChem CID 130523252) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol.
Molecular Properties
| Compound Name | 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol |
| PubChem CID | 130523252 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol |
| SMILES | C/C=C/CN1CC(O)CO1 |
| InChI | InChI=1S/C7H13NO2/c1-2-3-4-8-5-7(9)6-10-8/h2-3,7,9H,4-6H2,1H3/b3-2+ |
| InChIKey | OBDGCKRNVMBQGF-NSCUHMNNSA-N |
| XLogP | 0.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol?
The IUPAC name of 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol (CID 130523252) is 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol.
What is the SMILES notation for 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol?
The canonical SMILES for 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol is C/C=C/CN1CC(O)CO1.
What is the InChIKey of 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol?
The InChIKey is OBDGCKRNVMBQGF-NSCUHMNNSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-3-4-8-5-7(9)6-10-8/h2-3,7,9H,4-6H2,1H3/b3-2+.
What are the key properties of 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol?
2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol has a molecular weight of 143.19 g/mol, XLogP of 0.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-but-2-enyl]-1,2-oxazolidin-4-ol is sourced from PubChem (CID 130523252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).