About (4S)-2-ethyl-1,2-oxazolidin-4-ol
(4S)-2-ethyl-1,2-oxazolidin-4-ol (PubChem CID 130523460) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is (4S)-2-ethyl-1,2-oxazolidin-4-ol.
Molecular Properties
| Compound Name | (4S)-2-ethyl-1,2-oxazolidin-4-ol |
| PubChem CID | 130523460 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | (4S)-2-ethyl-1,2-oxazolidin-4-ol |
| SMILES | CCN1C[C@H](O)CO1 |
| InChI | InChI=1S/C5H11NO2/c1-2-6-3-5(7)4-8-6/h5,7H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | LJPIQFMAKSPKRY-YFKPBYRVSA-N |
| XLogP | -0.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-2-ethyl-1,2-oxazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-ethyl-1,2-oxazolidin-4-ol?
The IUPAC name of (4S)-2-ethyl-1,2-oxazolidin-4-ol (CID 130523460) is (4S)-2-ethyl-1,2-oxazolidin-4-ol.
What is the SMILES notation for (4S)-2-ethyl-1,2-oxazolidin-4-ol?
The canonical SMILES for (4S)-2-ethyl-1,2-oxazolidin-4-ol is CCN1C[C@H](O)CO1.
What is the InChIKey of (4S)-2-ethyl-1,2-oxazolidin-4-ol?
The InChIKey is LJPIQFMAKSPKRY-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H11NO2/c1-2-6-3-5(7)4-8-6/h5,7H,2-4H2,1H3/t5-/m0/s1.
What are the key properties of (4S)-2-ethyl-1,2-oxazolidin-4-ol?
(4S)-2-ethyl-1,2-oxazolidin-4-ol has a molecular weight of 117.15 g/mol, XLogP of -0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-ethyl-1,2-oxazolidin-4-ol is sourced from PubChem (CID 130523460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).