C5H11NO2 — CID 130523460
(4S)-2-ethyl-1,2-oxazolidin-4-ol (PubChem CID 130523460) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is (4S)-2-ethyl-1,2-oxazolidin-4-ol.
| Compound Name | (4S)-2-ethyl-1,2-oxazolidin-4-ol |
|---|---|
| PubChem CID | 130523460 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | (4S)-2-ethyl-1,2-oxazolidin-4-ol |
| SMILES | CCN1C[C@H](O)CO1 |
| InChI | InChI=1S/C5H11NO2/c1-2-6-3-5(7)4-8-6/h5,7H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | LJPIQFMAKSPKRY-YFKPBYRVSA-N |
| XLogP | -0.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |