About (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol
(4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol (PubChem CID 130523509) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol.
Molecular Properties
| Compound Name | (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol |
| PubChem CID | 130523509 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol |
| SMILES | COCC(C)N1C[C@H](O)CO1 |
| InChI | InChI=1S/C7H15NO3/c1-6(4-10-2)8-3-7(9)5-11-8/h6-7,9H,3-5H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | LMLCJOJDIKPGCU-MLWJPKLSSA-N |
| XLogP | -0.37 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol?
The IUPAC name of (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol (CID 130523509) is (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol.
What is the SMILES notation for (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol?
The canonical SMILES for (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol is COCC(C)N1C[C@H](O)CO1.
What is the InChIKey of (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol?
The InChIKey is LMLCJOJDIKPGCU-MLWJPKLSSA-N. The full InChI is InChI=1S/C7H15NO3/c1-6(4-10-2)8-3-7(9)5-11-8/h6-7,9H,3-5H2,1-2H3/t6?,7-/m0/s1.
What are the key properties of (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol?
(4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol has a molecular weight of 161.20 g/mol, XLogP of -0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-(1-methoxypropan-2-yl)-1,2-oxazolidin-4-ol is sourced from PubChem (CID 130523509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).