About 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine
2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine (PubChem CID 130524941) has the molecular formula C8H10BrNS2
and a molecular weight of 264.21 g/mol. Its IUPAC name is 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine |
| PubChem CID | 130524941 |
| Molecular Formula | C8H10BrNS2 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 262.94 |
| IUPAC Name | 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine |
| SMILES | CC1CNC(c2cscc2Br)S1 |
| InChI | InChI=1S/C8H10BrNS2/c1-5-2-10-8(12-5)6-3-11-4-7(6)9/h3-5,8,10H,2H2,1H3 |
| InChIKey | CTLUBFWUJXLHIE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine?
The IUPAC name of 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine (CID 130524941) is 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine.
What is the SMILES notation for 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine?
The canonical SMILES for 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine is CC1CNC(c2cscc2Br)S1.
What is the InChIKey of 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine?
The InChIKey is CTLUBFWUJXLHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNS2/c1-5-2-10-8(12-5)6-3-11-4-7(6)9/h3-5,8,10H,2H2,1H3.
What are the key properties of 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine?
2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine has a molecular weight of 264.21 g/mol, XLogP of 3.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromothiophen-3-yl)-5-methyl-1,3-thiazolidine is sourced from PubChem (CID 130524941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).