C11H15FN2 — CID 130526503
8-fluoro-2-propan-2-yl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 130526503) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 8-fluoro-2-propan-2-yl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 8-fluoro-2-propan-2-yl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 130526503 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 8-fluoro-2-propan-2-yl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | CC(C)C1CNc2cccc(F)c2N1 |
| InChI | InChI=1S/C11H15FN2/c1-7(2)10-6-13-9-5-3-4-8(12)11(9)14-10/h3-5,7,10,13-14H,6H2,1-2H3 |
| InChIKey | CLTMIEYQTILTLA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |