C7H5F4IN2O — CID 130526689
5-iodo-3-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-one (PubChem CID 130526689) has the molecular formula C7H5F4IN2O and a molecular weight of 336.03 g/mol. Its IUPAC name is 5-iodo-3-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-one.
| Compound Name | 5-iodo-3-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 130526689 |
| Molecular Formula | C7H5F4IN2O |
| Molecular Weight | 336.03 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 5-iodo-3-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-one |
| SMILES | O=c1c(I)cncn1CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H5F4IN2O/c8-6(9)7(10,11)2-14-3-13-1-4(12)5(14)15/h1,3,6H,2H2 |
| InChIKey | IUKZWAKFDNXMLE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.03 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|