(E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid

C8H10N2O2 — CID 130527511

IUPAC(E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid
SMILESCc1cnn(C)c1/C=C/C(=O)O
InChIInChI=1S/C8H10N2O2/c1-6-5-9-10(2)7(6)3-4-8(11)12/h3-5H,1-2H3,(H,11,12)/b4-3+
InChIKeyIDKUIHFYEUQDGA-ONEGZZNKSA-N
MW166.18 g/mol
LogP0.83
Rot. Bonds2

About (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid

(E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid (PubChem CID 130527511) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid
PubChem CID130527511
Molecular FormulaC8H10N2O2
Molecular Weight166.18 g/mol
Exact Mass166.07
IUPAC Name(E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid
SMILESCc1cnn(C)c1/C=C/C(=O)O
InChIInChI=1S/C8H10N2O2/c1-6-5-9-10(2)7(6)3-4-8(11)12/h3-5H,1-2H3,(H,11,12)/b4-3+
InChIKeyIDKUIHFYEUQDGA-ONEGZZNKSA-N
XLogP0.83
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.18
LogP ≤ 50.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid?
The IUPAC name of (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid (CID 130527511) is (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid is Cc1cnn(C)c1/C=C/C(=O)O.
What is the InChIKey of (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid?
The InChIKey is IDKUIHFYEUQDGA-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-6-5-9-10(2)7(6)3-4-8(11)12/h3-5H,1-2H3,(H,11,12)/b4-3+.
What are the key properties of (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid?
(E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid has a molecular weight of 166.18 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1,4-dimethylpyrazol-5-yl)prop-2-enoic acid is sourced from PubChem (CID 130527511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).