About (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone
(1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone (PubChem CID 130530261) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone.
Molecular Properties
| Compound Name | (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone |
| PubChem CID | 130530261 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)c2ncnn2C)nn1C |
| InChI | InChI=1S/C9H11N5O/c1-6-4-7(12-13(6)2)8(15)9-10-5-11-14(9)3/h4-5H,1-3H3 |
| InChIKey | IUHLWIRNCCUCNJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone?
The IUPAC name of (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone (CID 130530261) is (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone.
What is the SMILES notation for (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone?
The canonical SMILES for (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone is Cc1cc(C(=O)c2ncnn2C)nn1C.
What is the InChIKey of (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone?
The InChIKey is IUHLWIRNCCUCNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-6-4-7(12-13(6)2)8(15)9-10-5-11-14(9)3/h4-5H,1-3H3.
What are the key properties of (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone?
(1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone has a molecular weight of 205.22 g/mol, XLogP of 0.09, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,5-dimethylpyrazol-3-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone is sourced from PubChem (CID 130530261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).