About (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone
(4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone (PubChem CID 130530279) has the molecular formula C8H8N4OS
and a molecular weight of 208.25 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone.
Molecular Properties
| Compound Name | (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone |
| PubChem CID | 130530279 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone |
| SMILES | Cc1ncsc1C(=O)c1ncnn1C |
| InChI | InChI=1S/C8H8N4OS/c1-5-7(14-4-10-5)6(13)8-9-3-11-12(8)2/h3-4H,1-2H3 |
| InChIKey | KXCSAWQSEIGNEV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone?
The IUPAC name of (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone (CID 130530279) is (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone.
What is the SMILES notation for (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone?
The canonical SMILES for (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone is Cc1ncsc1C(=O)c1ncnn1C.
What is the InChIKey of (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone?
The InChIKey is KXCSAWQSEIGNEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4OS/c1-5-7(14-4-10-5)6(13)8-9-3-11-12(8)2/h3-4H,1-2H3.
What are the key properties of (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone?
(4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone has a molecular weight of 208.25 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,3-thiazol-5-yl)-(2-methyl-1,2,4-triazol-3-yl)methanone is sourced from PubChem (CID 130530279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).