About N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine
N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine (PubChem CID 130530358) has the molecular formula C9H16N4S
and a molecular weight of 212.32 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine |
| PubChem CID | 130530358 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine |
| SMILES | CNC(c1ncnn1C)C1CCSC1 |
| InChI | InChI=1S/C9H16N4S/c1-10-8(7-3-4-14-5-7)9-11-6-12-13(9)2/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | PXNXJSOXJDGQLK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine?
The IUPAC name of N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine (CID 130530358) is N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine.
What is the SMILES notation for N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine?
The canonical SMILES for N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine is CNC(c1ncnn1C)C1CCSC1.
What is the InChIKey of N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine?
The InChIKey is PXNXJSOXJDGQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4S/c1-10-8(7-3-4-14-5-7)9-11-6-12-13(9)2/h6-8,10H,3-5H2,1-2H3.
What are the key properties of N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine?
N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine has a molecular weight of 212.32 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)-1-(thiolan-3-yl)methanamine is sourced from PubChem (CID 130530358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).