C10H11ClFN — CID 130530778
8-chloro-6-fluoro-4-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 130530778) has the molecular formula C10H11ClFN and a molecular weight of 199.66 g/mol. Its IUPAC name is 8-chloro-6-fluoro-4-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-chloro-6-fluoro-4-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 130530778 |
| Molecular Formula | C10H11ClFN |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 8-chloro-6-fluoro-4-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCNc2c(Cl)cc(F)cc21 |
| InChI | InChI=1S/C10H11ClFN/c1-6-2-3-13-10-8(6)4-7(12)5-9(10)11/h4-6,13H,2-3H2,1H3 |
| InChIKey | SSAZGRWXCBMEAK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |