C26H34O7S — CID 13053250
[1,1-dimethoxy-1-(6-methoxynaphthalen-2-yl)propan-2-yl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 13053250) has the molecular formula C26H34O7S and a molecular weight of 490.62 g/mol. Its IUPAC name is [1,1-dimethoxy-1-(6-methoxynaphthalen-2-yl)propan-2-yl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | [1,1-dimethoxy-1-(6-methoxynaphthalen-2-yl)propan-2-yl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 13053250 |
| Molecular Formula | C26H34O7S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [1,1-dimethoxy-1-(6-methoxynaphthalen-2-yl)propan-2-yl] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | COc1ccc2cc(C(OC)(OC)C(C)OS(=O)(=O)CC34CCC(CC3=O)C4(C)C)ccc2c1 |
| InChI | InChI=1S/C26H34O7S/c1-17(33-34(28,29)16-25-12-11-20(15-23(25)27)24(25,2)3)26(31-5,32-6)21-9-7-19-14-22(30-4)10-8-18(19)13-21/h7-10,13-14,17,20H,11-12,15-16H2,1-6H3 |
| InChIKey | SJHNBXBCXTWIDL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|