C9H17N5 — CID 130532591
2-N-(3-methylpentan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 130532591) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-N-(3-methylpentan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-methylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130532591 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 2-N-(3-methylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(C)C(C)Nc1ncnc(N)n1 |
| InChI | InChI=1S/C9H17N5/c1-4-6(2)7(3)13-9-12-5-11-8(10)14-9/h5-7H,4H2,1-3H3,(H3,10,11,12,13,14) |
| InChIKey | SFPFYESHIXMJHO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |