C7H11N5S — CID 130532811
2-N-(thiolan-3-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 130532811) has the molecular formula C7H11N5S and a molecular weight of 197.27 g/mol. Its IUPAC name is 2-N-(thiolan-3-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(thiolan-3-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130532811 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-N-(thiolan-3-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ncnc(NC2CCSC2)n1 |
| InChI | InChI=1S/C7H11N5S/c8-6-9-4-10-7(12-6)11-5-1-2-13-3-5/h4-5H,1-3H2,(H3,8,9,10,11,12) |
| InChIKey | RXOPJTFYLNCMHF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |