C10H13N3O — CID 130533248
(E)-4-amino-N-(3-methyl-4-pyridinyl)but-2-enamide (PubChem CID 130533248) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is (E)-4-amino-N-(3-methyl-4-pyridinyl)but-2-enamide.
| Compound Name | (E)-4-amino-N-(3-methyl-4-pyridinyl)but-2-enamide |
|---|---|
| PubChem CID | 130533248 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (E)-4-amino-N-(3-methyl-4-pyridinyl)but-2-enamide |
| SMILES | Cc1cnccc1NC(=O)/C=C/CN |
| InChI | InChI=1S/C10H13N3O/c1-8-7-12-6-4-9(8)13-10(14)3-2-5-11/h2-4,6-7H,5,11H2,1H3,(H,12,13,14)/b3-2+ |
| InChIKey | HALXDZHAYBWSHA-NSCUHMNNSA-N |
| XLogP | 0.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|