About 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine
2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 130535565) has the molecular formula C9H10ClN3S
and a molecular weight of 227.72 g/mol. Its IUPAC name is 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine |
| PubChem CID | 130535565 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCN(C)c1nc(Cl)nc2ccsc12 |
| InChI | InChI=1S/C9H10ClN3S/c1-3-13(2)8-7-6(4-5-14-7)11-9(10)12-8/h4-5H,3H2,1-2H3 |
| InChIKey | SIOMLFUYHLZNSB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine?
The IUPAC name of 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine (CID 130535565) is 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine is CCN(C)c1nc(Cl)nc2ccsc12.
What is the InChIKey of 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine?
The InChIKey is SIOMLFUYHLZNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3S/c1-3-13(2)8-7-6(4-5-14-7)11-9(10)12-8/h4-5H,3H2,1-2H3.
What are the key properties of 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine?
2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine has a molecular weight of 227.72 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-ethyl-N-methylthieno[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 130535565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).