C7H13ClN2O2S — CID 130536670
2-[(E)-4-chlorobut-2-enyl]-5-methyl-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 130536670) has the molecular formula C7H13ClN2O2S and a molecular weight of 224.71 g/mol. Its IUPAC name is 2-[(E)-4-chlorobut-2-enyl]-5-methyl-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | 2-[(E)-4-chlorobut-2-enyl]-5-methyl-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 130536670 |
| Molecular Formula | C7H13ClN2O2S |
| Molecular Weight | 224.71 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-[(E)-4-chlorobut-2-enyl]-5-methyl-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | CN1CCN(C/C=C/CCl)S1(=O)=O |
| InChI | InChI=1S/C7H13ClN2O2S/c1-9-6-7-10(13(9,11)12)5-3-2-4-8/h2-3H,4-7H2,1H3/b3-2+ |
| InChIKey | WJAZVQSIPJOVCL-NSCUHMNNSA-N |
| XLogP | 0.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.71 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|