About ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate
ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate (PubChem CID 13053732) has the molecular formula C11H14Cl2O4
and a molecular weight of 281.14 g/mol. Its IUPAC name is ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate |
| PubChem CID | 13053732 |
| Molecular Formula | C11H14Cl2O4 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate |
| SMILES | CCOC(=O)C(Cl)(Cl)C1OC(=O)C2C1C2(C)C |
| InChI | InChI=1S/C11H14Cl2O4/c1-4-16-9(15)11(12,13)7-5-6(8(14)17-7)10(5,2)3/h5-7H,4H2,1-3H3 |
| InChIKey | JLSNDVCWSLNFIK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate?
The IUPAC name of ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate (CID 13053732) is ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate.
What is the SMILES notation for ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate?
The canonical SMILES for ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate is CCOC(=O)C(Cl)(Cl)C1OC(=O)C2C1C2(C)C.
What is the InChIKey of ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate?
The InChIKey is JLSNDVCWSLNFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2O4/c1-4-16-9(15)11(12,13)7-5-6(8(14)17-7)10(5,2)3/h5-7H,4H2,1-3H3.
What are the key properties of ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate?
ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate has a molecular weight of 281.14 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-dichloro-2-(6,6-dimethyl-4-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)acetate is sourced from PubChem (CID 13053732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).