About 2-propylquinolin-6-amine
2-propylquinolin-6-amine (PubChem CID 130537701) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-propylquinolin-6-amine.
Molecular Properties
| Compound Name | 2-propylquinolin-6-amine |
| PubChem CID | 130537701 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-propylquinolin-6-amine |
| SMILES | CCCc1ccc2cc(N)ccc2n1 |
| InChI | InChI=1S/C12H14N2/c1-2-3-11-6-4-9-8-10(13)5-7-12(9)14-11/h4-8H,2-3,13H2,1H3 |
| InChIKey | HGJCWFWIFVLHSQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propylquinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylquinolin-6-amine?
The IUPAC name of 2-propylquinolin-6-amine (CID 130537701) is 2-propylquinolin-6-amine.
What is the SMILES notation for 2-propylquinolin-6-amine?
The canonical SMILES for 2-propylquinolin-6-amine is CCCc1ccc2cc(N)ccc2n1.
What is the InChIKey of 2-propylquinolin-6-amine?
The InChIKey is HGJCWFWIFVLHSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-2-3-11-6-4-9-8-10(13)5-7-12(9)14-11/h4-8H,2-3,13H2,1H3.
What are the key properties of 2-propylquinolin-6-amine?
2-propylquinolin-6-amine has a molecular weight of 186.26 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylquinolin-6-amine is sourced from PubChem (CID 130537701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).