About sodium 1H-pyrazole-4-sulfinate
sodium 1H-pyrazole-4-sulfinate (PubChem CID 130538090) has the molecular formula C3H3N2NaO2S
and a molecular weight of 154.13 g/mol. Its IUPAC name is sodium 1H-pyrazole-4-sulfinate.
Molecular Properties
| Compound Name | sodium 1H-pyrazole-4-sulfinate |
| PubChem CID | 130538090 |
| Molecular Formula | C3H3N2NaO2S |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 153.98 |
| IUPAC Name | sodium 1H-pyrazole-4-sulfinate |
| SMILES | O=S([O-])c1cn[nH]c1.[Na+] |
| InChI | InChI=1S/C3H4N2O2S.Na/c6-8(7)3-1-4-5-2-3;/h1-2H,(H,4,5)(H,6,7);/q;+1/p-1 |
| InChIKey | CTBLZVSGIPYYEA-UHFFFAOYSA-M |
| XLogP | -3.35 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 1H-pyrazole-4-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1H-pyrazole-4-sulfinate?
The IUPAC name of sodium 1H-pyrazole-4-sulfinate (CID 130538090) is sodium 1H-pyrazole-4-sulfinate.
What is the SMILES notation for sodium 1H-pyrazole-4-sulfinate?
The canonical SMILES for sodium 1H-pyrazole-4-sulfinate is O=S([O-])c1cn[nH]c1.[Na+].
What is the InChIKey of sodium 1H-pyrazole-4-sulfinate?
The InChIKey is CTBLZVSGIPYYEA-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4N2O2S.Na/c6-8(7)3-1-4-5-2-3;/h1-2H,(H,4,5)(H,6,7);/q;+1/p-1.
What are the key properties of sodium 1H-pyrazole-4-sulfinate?
sodium 1H-pyrazole-4-sulfinate has a molecular weight of 154.13 g/mol, XLogP of -3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1H-pyrazole-4-sulfinate is sourced from PubChem (CID 130538090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).