About 1-butylpyrazin-2-one
1-butylpyrazin-2-one (PubChem CID 130538408) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-butylpyrazin-2-one.
Molecular Properties
| Compound Name | 1-butylpyrazin-2-one |
| PubChem CID | 130538408 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-butylpyrazin-2-one |
| SMILES | CCCCn1ccncc1=O |
| InChI | InChI=1S/C8H12N2O/c1-2-3-5-10-6-4-9-7-8(10)11/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | HTWAAAYMOWKSMF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpyrazin-2-one?
The IUPAC name of 1-butylpyrazin-2-one (CID 130538408) is 1-butylpyrazin-2-one.
What is the SMILES notation for 1-butylpyrazin-2-one?
The canonical SMILES for 1-butylpyrazin-2-one is CCCCn1ccncc1=O.
What is the InChIKey of 1-butylpyrazin-2-one?
The InChIKey is HTWAAAYMOWKSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-2-3-5-10-6-4-9-7-8(10)11/h4,6-7H,2-3,5H2,1H3.
What are the key properties of 1-butylpyrazin-2-one?
1-butylpyrazin-2-one has a molecular weight of 152.20 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpyrazin-2-one is sourced from PubChem (CID 130538408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).