About 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide
1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide (PubChem CID 130538433) has the molecular formula C7H12F2N2O2
and a molecular weight of 194.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide |
| PubChem CID | 130538433 |
| Molecular Formula | C7H12F2N2O2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1(O)CCN(CC(F)F)C1 |
| InChI | InChI=1S/C7H12F2N2O2/c8-5(9)3-11-2-1-7(13,4-11)6(10)12/h5,13H,1-4H2,(H2,10,12) |
| InChIKey | FZIYYOMEYWSLOL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide?
The IUPAC name of 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide (CID 130538433) is 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide.
What is the SMILES notation for 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide?
The canonical SMILES for 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide is NC(=O)C1(O)CCN(CC(F)F)C1.
What is the InChIKey of 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide?
The InChIKey is FZIYYOMEYWSLOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N2O2/c8-5(9)3-11-2-1-7(13,4-11)6(10)12/h5,13H,1-4H2,(H2,10,12).
What are the key properties of 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide?
1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide has a molecular weight of 194.18 g/mol, XLogP of -0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-3-hydroxypyrrolidine-3-carboxamide is sourced from PubChem (CID 130538433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).