C7H6N4O2 — CID 130541021
2-[(5-cyanopyrimidin-4-yl)amino]acetic acid (PubChem CID 130541021) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 2-[(5-cyanopyrimidin-4-yl)amino]acetic acid.
| Compound Name | 2-[(5-cyanopyrimidin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 130541021 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2-[(5-cyanopyrimidin-4-yl)amino]acetic acid |
| SMILES | N#Cc1cncnc1NCC(=O)O |
| InChI | InChI=1S/C7H6N4O2/c8-1-5-2-9-4-11-7(5)10-3-6(12)13/h2,4H,3H2,(H,12,13)(H,9,10,11) |
| InChIKey | MKFZPRFOGYUWGT-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |