About N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline
N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline (PubChem CID 130541161) has the molecular formula C10H9IN2S
and a molecular weight of 316.17 g/mol. Its IUPAC name is N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline |
| PubChem CID | 130541161 |
| Molecular Formula | C10H9IN2S |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline |
| SMILES | Ic1cnc(CNc2ccccc2)s1 |
| InChI | InChI=1S/C10H9IN2S/c11-9-6-13-10(14-9)7-12-8-4-2-1-3-5-8/h1-6,12H,7H2 |
| InChIKey | NSAVHSOFWMMNLN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline?
The IUPAC name of N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline (CID 130541161) is N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline.
What is the SMILES notation for N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline?
The canonical SMILES for N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline is Ic1cnc(CNc2ccccc2)s1.
What is the InChIKey of N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline?
The InChIKey is NSAVHSOFWMMNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2S/c11-9-6-13-10(14-9)7-12-8-4-2-1-3-5-8/h1-6,12H,7H2.
What are the key properties of N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline?
N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline has a molecular weight of 316.17 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline is sourced from PubChem (CID 130541161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).