C5H3IN4S2 — CID 130541330
3-(5-iodo-1,3-thiazol-2-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 130541330) has the molecular formula C5H3IN4S2 and a molecular weight of 310.15 g/mol. Its IUPAC name is 3-(5-iodo-1,3-thiazol-2-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(5-iodo-1,3-thiazol-2-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 130541330 |
| Molecular Formula | C5H3IN4S2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.88 |
| IUPAC Name | 3-(5-iodo-1,3-thiazol-2-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(-c2ncc(I)s2)ns1 |
| InChI | InChI=1S/C5H3IN4S2/c6-2-1-8-4(11-2)3-9-5(7)12-10-3/h1H,(H2,7,9,10) |
| InChIKey | QGXNNLHKRJDCOJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|