About 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile
2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile (PubChem CID 130541770) has the molecular formula C8H7IN2OS
and a molecular weight of 306.13 g/mol. Its IUPAC name is 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile |
| PubChem CID | 130541770 |
| Molecular Formula | C8H7IN2OS |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile |
| SMILES | N#CC1CCOC1c1ncc(I)s1 |
| InChI | InChI=1S/C8H7IN2OS/c9-6-4-11-8(13-6)7-5(3-10)1-2-12-7/h4-5,7H,1-2H2 |
| InChIKey | ASYHSHGRXPDQRG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile?
The IUPAC name of 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile (CID 130541770) is 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile.
What is the SMILES notation for 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile?
The canonical SMILES for 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile is N#CC1CCOC1c1ncc(I)s1.
What is the InChIKey of 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile?
The InChIKey is ASYHSHGRXPDQRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IN2OS/c9-6-4-11-8(13-6)7-5(3-10)1-2-12-7/h4-5,7H,1-2H2.
What are the key properties of 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile?
2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile has a molecular weight of 306.13 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-iodo-1,3-thiazol-2-yl)oxolane-3-carbonitrile is sourced from PubChem (CID 130541770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).