About 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol
1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol (PubChem CID 130542427) has the molecular formula C8H12ClN3OS
and a molecular weight of 233.72 g/mol. Its IUPAC name is 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol |
| PubChem CID | 130542427 |
| Molecular Formula | C8H12ClN3OS |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol |
| SMILES | OC1CNCCN(c2nc(Cl)cs2)C1 |
| InChI | InChI=1S/C8H12ClN3OS/c9-7-5-14-8(11-7)12-2-1-10-3-6(13)4-12/h5-6,10,13H,1-4H2 |
| InChIKey | ZGJYZRNTMAETTM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol?
The IUPAC name of 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol (CID 130542427) is 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol.
What is the SMILES notation for 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol?
The canonical SMILES for 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol is OC1CNCCN(c2nc(Cl)cs2)C1.
What is the InChIKey of 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol?
The InChIKey is ZGJYZRNTMAETTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN3OS/c9-7-5-14-8(11-7)12-2-1-10-3-6(13)4-12/h5-6,10,13H,1-4H2.
What are the key properties of 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol?
1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol has a molecular weight of 233.72 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-6-ol is sourced from PubChem (CID 130542427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).