About 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine
4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine (PubChem CID 130542974) has the molecular formula C7H7N3O2S2
and a molecular weight of 229.29 g/mol. Its IUPAC name is 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine |
| PubChem CID | 130542974 |
| Molecular Formula | C7H7N3O2S2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine |
| SMILES | CS(=O)(=O)c1ncnc2sc(N)cc12 |
| InChI | InChI=1S/C7H7N3O2S2/c1-14(11,12)7-4-2-5(8)13-6(4)9-3-10-7/h2-3H,8H2,1H3 |
| InChIKey | KUFRWRKWZNTPNP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine?
The IUPAC name of 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine (CID 130542974) is 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine.
What is the SMILES notation for 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine?
The canonical SMILES for 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine is CS(=O)(=O)c1ncnc2sc(N)cc12.
What is the InChIKey of 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine?
The InChIKey is KUFRWRKWZNTPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S2/c1-14(11,12)7-4-2-5(8)13-6(4)9-3-10-7/h2-3H,8H2,1H3.
What are the key properties of 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine?
4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine has a molecular weight of 229.29 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonylthieno[2,3-d]pyrimidin-6-amine is sourced from PubChem (CID 130542974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).