About 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane
2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 130543722) has the molecular formula C7H13FN2
and a molecular weight of 144.19 g/mol. Its IUPAC name is 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 130543722 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | FCCN1CC2CC1CN2 |
| InChI | InChI=1S/C7H13FN2/c8-1-2-10-5-6-3-7(10)4-9-6/h6-7,9H,1-5H2 |
| InChIKey | WREJIDFBDNBDCT-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane (CID 130543722) is 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane is FCCN1CC2CC1CN2.
What is the InChIKey of 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is WREJIDFBDNBDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FN2/c8-1-2-10-5-6-3-7(10)4-9-6/h6-7,9H,1-5H2.
What are the key properties of 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane?
2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 144.19 g/mol, XLogP of 0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroethyl)-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 130543722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).