About 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid
1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid (PubChem CID 130545395) has the molecular formula C8H7N5O2
and a molecular weight of 205.18 g/mol. Its IUPAC name is 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid |
| PubChem CID | 130545395 |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cncc3nnnn23)CC1 |
| InChI | InChI=1S/C8H7N5O2/c14-7(15)8(1-2-8)5-3-9-4-6-10-11-12-13(5)6/h3-4H,1-2H2,(H,14,15) |
| InChIKey | OFHINMNKWYCUKJ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid?
The IUPAC name of 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid (CID 130545395) is 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid is O=C(O)C1(c2cncc3nnnn23)CC1.
What is the InChIKey of 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid?
The InChIKey is OFHINMNKWYCUKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2/c14-7(15)8(1-2-8)5-3-9-4-6-10-11-12-13(5)6/h3-4H,1-2H2,(H,14,15).
What are the key properties of 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid?
1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid has a molecular weight of 205.18 g/mol, XLogP of -0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(tetrazolo[1,5-a]pyrazin-5-yl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 130545395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).