C7H10F3N3O — CID 130549069
2,2,2-trifluoro-1-(1-propan-2-yltriazol-4-yl)ethanol (PubChem CID 130549069) has the molecular formula C7H10F3N3O and a molecular weight of 209.17 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1-propan-2-yltriazol-4-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(1-propan-2-yltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 130549069 |
| Molecular Formula | C7H10F3N3O |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2,2,2-trifluoro-1-(1-propan-2-yltriazol-4-yl)ethanol |
| SMILES | CC(C)n1cc(C(O)C(F)(F)F)nn1 |
| InChI | InChI=1S/C7H10F3N3O/c1-4(2)13-3-5(11-12-13)6(14)7(8,9)10/h3-4,6,14H,1-2H3 |
| InChIKey | KSQLJCMFAKPTMS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |